Structure of PDB 3w75 Chain B Binding Site BS01 |
|
|
Ligand ID | W75 |
InChI | InChI=1S/C15H16N2O6/c1-22-9-5-8(6-10(7-9)23-2)3-4-11-12(14(19)20)16-15(21)17-13(11)18/h5-7H,3-4H2,1-2H3,(H,19,20)(H2,16,17,18,21) |
InChIKey | WVWPBPAOHICERF-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | COc1cc(cc(c1)OC)CCC2=C(NC(=O)NC2=O)C(=O)O | CACTVS 3.370 | COc1cc(CCC2=C(NC(=O)NC2=O)C(O)=O)cc(OC)c1 | ACDLabs 12.01 | O=C1NC(C(=O)O)=C(C(=O)N1)CCc2cc(OC)cc(OC)c2 |
|
Formula | C15 H16 N2 O6 |
Name | 5-[2-(3,5-dimethoxyphenyl)ethyl]-2,6-dioxo-1,2,3,6-tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3990712 |
DrugBank | |
ZINC | ZINC000098209551
|
PDB chain | 3w75 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|