Structure of PDB 3w72 Chain B Binding Site BS01 |
|
|
Ligand ID | W7B |
InChI | InChI=1S/C17H14N2O4/c20-15-13(14(16(21)22)18-17(23)19-15)9-8-11-6-3-5-10-4-1-2-7-12(10)11/h1-7H,8-9H2,(H,21,22)(H2,18,19,20,23) |
InChIKey | SLNOQVWHLSWYRT-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC(=O)C1=C(CCc2cccc3ccccc23)C(=O)NC(=O)N1 | OpenEye OEToolkits 1.7.6 | c1ccc2c(c1)cccc2CCC3=C(NC(=O)NC3=O)C(=O)O |
|
Formula | C17 H14 N2 O4 |
Name | 5-[2-(naphthalen-1-yl)ethyl]-2,6-dioxo-1,2,3,6- tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3990337 |
DrugBank | |
ZINC | ZINC000098209554
|
PDB chain | 3w72 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|