Structure of PDB 3w71 Chain B Binding Site BS01 |
|
|
Ligand ID | W7A |
InChI | InChI=1S/C19H16N2O4/c22-17-15(16(18(23)24)20-19(25)21-17)11-8-12-6-9-14(10-7-12)13-4-2-1-3-5-13/h1-7,9-10H,8,11H2,(H,23,24)(H2,20,21,22,25) |
InChIKey | UYFCRZJXNNSAAC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | c1ccc(cc1)c2ccc(cc2)CCC3=C(NC(=O)NC3=O)C(=O)O | CACTVS 3.370 | OC(=O)C1=C(CCc2ccc(cc2)c3ccccc3)C(=O)NC(=O)N1 |
|
Formula | C19 H16 N2 O4 |
Name | 2,6-dioxo-5-[2-(4-phenylphenyl)ethyl]-1,2,3,6- tetrahydropyrimidine-4-carboxylic acid |
ChEMBL | CHEMBL3990960 |
DrugBank | |
ZINC | ZINC000098209553
|
PDB chain | 3w71 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|