Structure of PDB 3vff Chain B Binding Site BS01 |
|
|
Ligand ID | CD8 |
InChI | InChI=1S/C16H16N2O5S/c1-10-8-24-15(17-12(10)14(21)22)16(9-19,23-2)18-13(20)11-6-4-3-5-7-11/h3-7,9,15H,1,8H2,2H3,(H,18,20)(H,21,22)/t15-,16+/m1/s1 |
InChIKey | DDPBNTJUSOYARI-CVEARBPZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | CO[C@@](C=O)([C@@H]1N=C(C(=C)CS1)C(=O)O)NC(=O)c2ccccc2 | CACTVS 3.370 | CO[C@@](NC(=O)c1ccccc1)(C=O)[C@H]2SCC(=C)C(=N2)C(O)=O | CACTVS 3.370 | CO[C](NC(=O)c1ccccc1)(C=O)[CH]2SCC(=C)C(=N2)C(O)=O | OpenEye OEToolkits 1.7.6 | COC(C=O)(C1N=C(C(=C)CS1)C(=O)O)NC(=O)c2ccccc2 | ACDLabs 12.01 | O=CC(OC)(NC(=O)c1ccccc1)C2N=C(C(=O)O)\C(=C)CS2 |
|
Formula | C16 H16 N2 O5 S |
Name | (2R)-2-[(1S)-1-(benzoylamino)-1-methoxy-2-oxoethyl]-5-methylidene-5,6-dihydro-2H-1,3-thiazine-4-carboxylic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095921292
|
PDB chain | 3vff Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|