Structure of PDB 3v7t Chain B Binding Site BS01 |
|
|
Ligand ID | 0GX |
InChI | InChI=1S/C23H28BrFN2O2S/c1-3-8-29-23-20(24)13(2)21(30-23)22(28)27-16-5-6-17(27)11-15(10-16)18-9-14(12-26)4-7-19(18)25/h4,7,9,15-17H,3,5-6,8,10-12,26H2,1-2H3/t15-,16-,17+ |
InChIKey | SZKGHXMOYDKXPX-OSYLJGHBSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Fc1ccc(cc1C3CC4N(C(=O)c2sc(OCCC)c(Br)c2C)C(C3)CC4)CN | OpenEye OEToolkits 1.7.6 | CCCOc1c(c(c(s1)C(=O)N2[C@@H]3CC[C@H]2CC(C3)c4cc(ccc4F)CN)C)Br | CACTVS 3.370 | CCCOc1sc(c(C)c1Br)C(=O)N2[CH]3CC[CH]2CC(C3)c4cc(CN)ccc4F | OpenEye OEToolkits 1.7.6 | CCCOc1c(c(c(s1)C(=O)N2C3CCC2CC(C3)c4cc(ccc4F)CN)C)Br | CACTVS 3.370 | CCCOc1sc(c(C)c1Br)C(=O)N2[C@@H]3CC[C@H]2CC(C3)c4cc(CN)ccc4F |
|
Formula | C23 H28 Br F N2 O2 S |
Name | {(3-exo)-3-[5-(aminomethyl)-2-fluorophenyl]-8-azabicyclo[3.2.1]oct-8-yl}(4-bromo-3-methyl-5-propoxythiophen-2-yl)methanone |
ChEMBL | |
DrugBank | |
ZINC | ZINC000263621066
|
PDB chain | 3v7t Chain B Residue 301
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|