Structure of PDB 3tu9 Chain B Binding Site BS01 |
|
|
Ligand ID | 5MM |
InChI | InChI=1S/C7H18O12P2/c1-17-5(3-19-21(14,15)16)7(10)6(9)4(8)2-18-20(11,12)13/h4-10H,2-3H2,1H3,(H2,11,12,13)(H2,14,15,16)/t4-,5-,6-,7-/m1/s1 |
InChIKey | QXWUAOXRWVSNDB-DBRKOABJSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CO[CH](CO[P](O)(O)=O)[CH](O)[CH](O)[CH](O)CO[P](O)(O)=O | OpenEye OEToolkits 1.7.2 | CO[C@H](COP(=O)(O)O)[C@H]([C@@H]([C@@H](COP(=O)(O)O)O)O)O | CACTVS 3.370 | CO[C@H](CO[P](O)(O)=O)[C@@H](O)[C@H](O)[C@H](O)CO[P](O)(O)=O | OpenEye OEToolkits 1.7.2 | COC(COP(=O)(O)O)C(C(C(COP(=O)(O)O)O)O)O | ACDLabs 12.01 | O=P(OCC(OC)C(O)C(O)C(O)COP(=O)(O)O)(O)O |
|
Formula | C7 H18 O12 P2 |
Name | 2-O-methyl-1,6-di-O-phosphono-D-mannitol |
ChEMBL | CHEMBL2017785 |
DrugBank | |
ZINC | ZINC000084616343
|
PDB chain | 3tu9 Chain B Residue 364
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|