Structure of PDB 3tgs Chain B Binding Site BS01 |
|
|
Ligand ID | 03G |
InChI | InChI=1S/C17H24ClN3O2/c1-16(2)9-13(10-17(3,4)21-16)20-15(23)14(22)19-12-7-5-11(18)6-8-12/h5-8,13,21H,9-10H2,1-4H3,(H,19,22)(H,20,23) |
InChIKey | ZKXLQCIOURANAD-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | Clc1ccc(cc1)NC(=O)C(=O)NC2CC(NC(C)(C)C2)(C)C | OpenEye OEToolkits 1.7.6 | CC1(CC(CC(N1)(C)C)NC(=O)C(=O)Nc2ccc(cc2)Cl)C | CACTVS 3.370 | CC1(C)CC(CC(C)(C)N1)NC(=O)C(=O)Nc2ccc(Cl)cc2 |
|
Formula | C17 H24 Cl N3 O2 |
Name | N-(4-chlorophenyl)-N'-(2,2,6,6-tetramethylpiperidin-4-yl)ethanediamide; NBD-556 |
ChEMBL | CHEMBL254781 |
DrugBank | |
ZINC | ZINC000001780082
|
PDB chain | 3tgs Chain B Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|