Structure of PDB 3tcp Chain B Binding Site BS01 |
|
|
Ligand ID | CKJ |
InChI | InChI=1S/C22H29FN6/c1-2-3-12-25-22-26-13-19-20(16-6-8-17(23)9-7-16)28-29(21(19)27-22)14-15-4-10-18(24)11-5-15/h6-9,13,15,18H,2-5,10-12,14,24H2,1H3,(H,25,26,27)/t15-,18- |
InChIKey | OGEBRHQLRGFBNV-RZDIXWSQSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCCCNc1ncc2c(n1)n(C[C@@H]3CC[C@@H](N)CC3)nc2c4ccc(F)cc4 | ACDLabs 12.01 | Fc4ccc(c2nn(c1nc(ncc12)NCCCC)CC3CCC(N)CC3)cc4 | OpenEye OEToolkits 1.7.2 | CCCCNc1ncc2c(nn(c2n1)CC3CCC(CC3)N)c4ccc(cc4)F | CACTVS 3.370 | CCCCNc1ncc2c(n1)n(C[CH]3CC[CH](N)CC3)nc2c4ccc(F)cc4 |
|
Formula | C22 H29 F N6 |
Name | 1-[(trans-4-aminocyclohexyl)methyl]-N-butyl-3-(4-fluorophenyl)-1H-pyrazolo[3,4-d]pyrimidin-6-amine |
ChEMBL | CHEMBL2036808 |
DrugBank | |
ZINC |
|
PDB chain | 3tcp Chain B Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|