Structure of PDB 3srv Chain B Binding Site BS01 |
|
|
Ligand ID | S19 |
InChI | InChI=1S/C17H22N6O2/c1-10-2-4-11(5-3-10)21-16-12(15(19)24)8-20-17(23-16)22-14-6-7-25-9-13(14)18/h2-5,8,13-14H,6-7,9,18H2,1H3,(H2,19,24)(H2,20,21,22,23)/t13-,14+/m0/s1 |
InChIKey | KBPYMFSSFLOJPH-UONOGXRCSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | Cc1ccc(cc1)Nc2c(cnc(n2)NC3CCOCC3N)C(=O)N | CACTVS 3.370 | Cc1ccc(Nc2nc(N[CH]3CCOC[CH]3N)ncc2C(N)=O)cc1 | OpenEye OEToolkits 1.7.2 | Cc1ccc(cc1)Nc2c(cnc(n2)N[C@@H]3CCOC[C@@H]3N)C(=O)N | ACDLabs 12.01 | O=C(N)c1c(nc(nc1)NC2CCOCC2N)Nc3ccc(cc3)C | CACTVS 3.370 | Cc1ccc(Nc2nc(N[C@@H]3CCOC[C@@H]3N)ncc2C(N)=O)cc1 |
|
Formula | C17 H22 N6 O2 |
Name | 2-{[(3R,4R)-3-aminotetrahydro-2H-pyran-4-yl]amino}-4-[(4-methylphenyl)amino]pyrimidine-5-carboxamide; GSK143 |
ChEMBL | CHEMBL1835071 |
DrugBank | |
ZINC |
|
PDB chain | 3srv Chain B Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|