Structure of PDB 3smj Chain B Binding Site BS01 |
|
|
Ligand ID | FDR |
InChI | InChI=1S/C10H10N2OS/c1-5-11-9(13)8-6-3-2-4-7(6)14-10(8)12-5/h2-4H2,1H3,(H,11,12,13) |
InChIKey | SSAMSKJKRMKXFV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | CC1=Nc2c(c3c(s2)CCC3)C(=O)N1 | CACTVS 3.370 | CC1=Nc2sc3CCCc3c2C(=O)N1 | ACDLabs 12.01 | O=C1c2c3c(sc2N=C(N1)C)CCC3 |
|
Formula | C10 H10 N2 O S |
Name | 2-methyl-3,5,6,7-tetrahydro-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one |
ChEMBL | CHEMBL1300272 |
DrugBank | |
ZINC | ZINC000018213251
|
PDB chain | 3smj Chain B Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|