Structure of PDB 3s2v Chain B Binding Site BS01 |
|
|
Ligand ID | 3HU |
InChI | InChI=1S/C15H13N3O6S2/c16-9(13(20)21)4-17-10-6-25-5-8(10)12(19)18(15(17)24)3-7-1-2-26-11(7)14(22)23/h1-2,5-6,9H,3-4,16H2,(H,20,21)(H,22,23)/t9-/m0/s1 |
InChIKey | LSNSPQPOGKSTHQ-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | N[CH](CN1C(=O)N(Cc2ccsc2C(O)=O)C(=O)c3cscc13)C(O)=O | OpenEye OEToolkits 1.7.2 | c1csc(c1CN2C(=O)c3cscc3N(C2=O)CC(C(=O)O)N)C(=O)O | ACDLabs 12.01 | O=C(O)C(N)CN1C(=O)N(C(=O)c2cscc12)Cc3c(scc3)C(=O)O | OpenEye OEToolkits 1.7.2 | c1csc(c1CN2C(=O)c3cscc3N(C2=O)C[C@@H](C(=O)O)N)C(=O)O | CACTVS 3.370 | N[C@@H](CN1C(=O)N(Cc2ccsc2C(O)=O)C(=O)c3cscc13)C(O)=O |
|
Formula | C15 H13 N3 O6 S2 |
Name | (S)-1-(2'-AMINO-2'-CARBOXYETHYL)-3-[(2-CARBOXYTHIEN-3-YL)METHYL]THIENO[3,4-D]PYRIMIDIN-2,4-DIONE |
ChEMBL | CHEMBL1738726 |
DrugBank | |
ZINC | ZINC000066166242
|
PDB chain | 3s2v Chain B Residue 258
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|