Structure of PDB 3rw9 Chain B Binding Site BS01 |
|
|
Ligand ID | DSH |
InChI | InChI=1S/C13H20N6O3S/c14-2-1-3-23-4-7-9(20)10(21)13(22-7)19-6-18-8-11(15)16-5-17-12(8)19/h5-7,9-10,13,20-21H,1-4,14H2,(H2,15,16,17)/t7-,9-,10-,13-/m1/s1 |
InChIKey | FUSRAALGPJJIRO-QYVSTXNMSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.2 | c1nc(c2c(n1)n(cn2)C3C(C(C(O3)CSCCCN)O)O)N | CACTVS 3.370 | NCCCSC[C@H]1O[C@H]([C@H](O)[C@@H]1O)n2cnc3c(N)ncnc23 | CACTVS 3.370 | NCCCSC[CH]1O[CH]([CH](O)[CH]1O)n2cnc3c(N)ncnc23 | ACDLabs 12.01 | n2c1c(ncnc1n(c2)C3OC(C(O)C3O)CSCCCN)N | OpenEye OEToolkits 1.7.2 | c1nc(c2c(n1)n(cn2)[C@H]3[C@@H]([C@@H]([C@H](O3)CSCCCN)O)O)N |
|
Formula | C13 H20 N6 O3 S |
Name | 5'-S-(3-aminopropyl)-5'-thioadenosine |
ChEMBL | CHEMBL538693 |
DrugBank | |
ZINC | ZINC000005163039
|
PDB chain | 3rw9 Chain B Residue 303
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.5.1.16: spermidine synthase. |
|
|
|