Structure of PDB 3qn8 Chain B Binding Site BS01 |
|
|
Ligand ID | NI7 |
InChI | InChI=1S/C20H21N3O4/c24-15-5-1-3-13(7-15)11-22-17-9-21-10-18(17)23(20(27)19(22)26)12-14-4-2-6-16(25)8-14/h1-8,17-18,21,24-25H,9-12H2/t17-,18-/m0/s1 |
InChIKey | APIFWVNKKSBMAV-ROUUACIJSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc(cc(c1)O)CN2[C@H]3CNC[C@@H]3N(C(=O)C2=O)Cc4cccc(c4)O | CACTVS 3.370 | Oc1cccc(CN2[CH]3CNC[CH]3N(Cc4cccc(O)c4)C(=O)C2=O)c1 | ACDLabs 12.01 | O=C1C(=O)N(C3CNCC3N1Cc2cccc(O)c2)Cc4cccc(O)c4 | OpenEye OEToolkits 1.7.0 | c1cc(cc(c1)O)CN2C3CNCC3N(C(=O)C2=O)Cc4cccc(c4)O | CACTVS 3.370 | Oc1cccc(CN2[C@H]3CNC[C@@H]3N(Cc4cccc(O)c4)C(=O)C2=O)c1 |
|
Formula | C20 H21 N3 O4 |
Name | (4aS,7aS)-1,4-bis(3-hydroxybenzyl)hexahydro-1H-pyrrolo[3,4-b]pyrazine-2,3-dione |
ChEMBL | |
DrugBank | |
ZINC | ZINC000095920721
|
PDB chain | 3qn8 Chain B Residue 100
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|