Structure of PDB 3pr2 Chain B Binding Site BS01 |
|
|
Ligand ID | 7MN |
InChI | InChI=1S/C19H22N3O7P/c1-12-18(23)15(14(8-20-12)11-29-30(26,27)28)9-21-16(19(24)25)10-22-7-6-13-4-2-3-5-17(13)22/h2-5,8-9,20,23H,6-7,10-11H2,1H3,(H,24,25)(H2,26,27,28)/p+1/b15-9-,21-16+ |
InChIKey | MAJPVKFOYDGVKD-LNHPUNTFSA-O |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC1=C(/C(=C\[NH+]=C(/C[N@@]2CCc3c2cccc3)\C(=O)O)/C(=CN1)COP(=O)(O)O)O | CACTVS 3.370 | CC1=C(O)\C(=C/[NH+]=C(CN2CCc3ccccc23)C(O)=O)C(=CN1)CO[P](O)(O)=O | CACTVS 3.370 | CC1=C(O)C(=C[NH+]=C(CN2CCc3ccccc23)C(O)=O)C(=CN1)CO[P](O)(O)=O | OpenEye OEToolkits 1.7.0 | CC1=C(C(=C[NH+]=C(CN2CCc3c2cccc3)C(=O)O)C(=CN1)COP(=O)(O)O)O | ACDLabs 12.01 | O=P(O)(O)OCC\1=CNC(=C(O)C/1=C/[NH+]=C(/C(=O)O)CN3c2ccccc2CC3)C |
|
Formula | C19 H23 N3 O7 P |
Name | (Z)-N-[(1E)-1-carboxy-2-(2,3-dihydro-1H-indol-1-yl)ethylidene]{3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4(1H)-ylidene}methanaminium |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 3pr2 Chain B Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
K87 E109 S377 |
Catalytic site (residue number reindexed from 1) |
K85 E107 S375 |
Enzyme Commision number |
4.2.1.20: tryptophan synthase. |
|
|
|