Structure of PDB 3ozg Chain B Binding Site BS01 |
|
|
Ligand ID | SSI |
InChI | InChI=1S/C11H17N4O5P/c16-5-8(1-2-21(18,19)20)12-3-7-4-13-10-9(7)14-6-15-11(10)17/h4,6,8,12-13,16H,1-3,5H2,(H,14,15,17)(H2,18,19,20)/t8-/m0/s1 |
InChIKey | YYXVNWBGVIIBOW-QMMMGPOBSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | OC[CH](CC[P](O)(O)=O)NCc1c[nH]c2C(=O)NC=Nc12 | OpenEye OEToolkits 1.7.0 | c1c(c2c([nH]1)C(=O)NC=N2)CNC(CCP(=O)(O)O)CO | ACDLabs 12.01 | O=P(O)(O)CCC(NCc2c1N=CNC(=O)c1nc2)CO | OpenEye OEToolkits 1.7.0 | c1c(c2c([nH]1)C(=O)NC=N2)CN[C@@H](CCP(=O)(O)O)CO | CACTVS 3.370 | OC[C@H](CC[P](O)(O)=O)NCc1c[nH]c2C(=O)NC=Nc12 |
|
Formula | C11 H17 N4 O5 P |
Name | [(3S)-4-hydroxy-3-{[(4-oxo-4,5-dihydro-3H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]amino}butyl]phosphonic acid; S-SerMe-ImmH phosphonate |
ChEMBL | CHEMBL2414636 |
DrugBank | |
ZINC | ZINC000096282359
|
PDB chain | 3ozg Chain B Residue 233
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|