Structure of PDB 3o4v Chain B Binding Site BS01 |
|
|
Ligand ID | 4CT |
InChI | InChI=1S/C18H20ClN5OS/c19-13-1-3-14(4-2-13)26-9-12-7-24(8-15(12)25)6-11-5-21-17-16(11)22-10-23-18(17)20/h1-5,10,12,15,21,25H,6-9H2,(H2,20,22,23)/t12-,15+/m1/s1 |
InChIKey | MZZBHZOHYGEGEE-DOMZBBRYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Nc1ncnc2c(CN3C[CH](O)[CH](CSc4ccc(Cl)cc4)C3)c[nH]c12 | OpenEye OEToolkits 1.7.0 | c1cc(ccc1SC[C@H]2C[N@](C[C@@H]2O)Cc3c[nH]c4c3ncnc4N)Cl | ACDLabs 12.01 | Clc4ccc(SCC3CN(Cc2cnc1c2ncnc1N)CC3O)cc4 | OpenEye OEToolkits 1.7.0 | c1cc(ccc1SCC2CN(CC2O)Cc3c[nH]c4c3ncnc4N)Cl | CACTVS 3.370 | Nc1ncnc2c(CN3C[C@H](O)[C@@H](CSc4ccc(Cl)cc4)C3)c[nH]c12 |
|
Formula | C18 H20 Cl N5 O S |
Name | (3R,4S)-1-[(4-amino-5H-pyrrolo[3,2-d]pyrimidin-7-yl)methyl]-4-{[(4-chlorophenyl)sulfanyl]methyl}pyrrolidin-3-ol |
ChEMBL | CHEMBL1230265 |
DrugBank | |
ZINC | ZINC000011686335
|
PDB chain | 3o4v Chain B Residue 234
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.2.2.9: adenosylhomocysteine nucleosidase. |
|
|
|