Structure of PDB 3n4c Chain B Binding Site BS01 |
|
|
Ligand ID | EF3 |
InChI | InChI=1S/C23H27F3N6O/c1-30-7-9-32(10-8-30)6-3-11-33-21-5-4-16(12-17(21)23(24,25)26)18-13-20-22(19(14-27)29-18)28-15-31(20)2/h4-5,12-15,27H,3,6-11H2,1-2H3/b27-14+ |
InChIKey | MZJARPQAOGJEES-MZJWZYIUSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | [H]/N=C/c1c2c(cc(n1)c3ccc(c(c3)C(F)(F)F)OCCCN4CCN(CC4)C)n(cn2)C | CACTVS 3.370 | CN1CCN(CCCOc2ccc(cc2C(F)(F)F)c3cc4n(C)cnc4c(C=N)n3)CC1 | ACDLabs 12.01 | FC(F)(F)c4cc(c1nc(C=[N@H])c2ncn(c2c1)C)ccc4OCCCN3CCN(CC3)C | OpenEye OEToolkits 1.7.0 | Cn1cnc2c1cc(nc2C=N)c3ccc(c(c3)C(F)(F)F)OCCCN4CCN(CC4)C |
|
Formula | C23 H27 F3 N6 O |
Name | (E)-1-(1-methyl-6-{4-[3-(4-methylpiperazin-1-yl)propoxy]-3-(trifluoromethyl)phenyl}-1H-imidazo[4,5-c]pyridin-4-yl)methanimine |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 3n4c Chain B Residue 218
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|