Structure of PDB 3lw0 Chain B Binding Site BS01 |
|
|
Ligand ID | CCX |
InChI | InChI=1S/C28H28N6O/c29-15-19-7-8-26-25(14-19)20(17-31-26)4-1-2-11-34-12-9-22(10-13-34)33-28(35)24-6-3-5-23-21(16-30)18-32-27(23)24/h3,5-8,14,17-18,22,31-32H,1-2,4,9-13H2,(H,33,35) |
InChIKey | GVZDPXYOJHKYRC-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | O=C(NC1CCN(CCCCc2c[nH]c3ccc(cc23)C#N)CC1)c4cccc5c(c[nH]c45)C#N | OpenEye OEToolkits 1.7.0 | c1cc2c(c[nH]c2c(c1)C(=O)NC3CCN(CC3)CCCCc4c[nH]c5c4cc(cc5)C#N)C#N | ACDLabs 12.01 | N#Cc2c1cccc(c1nc2)C(=O)NC5CCN(CCCCc4c3cc(C#N)ccc3nc4)CC5 |
|
Formula | C28 H28 N6 O |
Name | 3-cyano-N-{1-[4-(5-cyano-1H-indol-3-yl)butyl]piperidin-4-yl}-1H-indole-7-carboxamide; 3-Cyano-1H-indole-7-carboxylic acid {1-[4-(5-cyano-1H-indol-3-yl)-butyl]-piperidin-4-yl}-amide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058632194
|
PDB chain | 3lw0 Chain B Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|