Structure of PDB 3l5c Chain B Binding Site BS01 |
|
|
Ligand ID | BDQ |
InChI | InChI=1S/C24H28N6O2/c1-16(2)12-24(3)21(31)30(22(26)29-24)15-19-6-4-18(5-7-19)14-27-23(32)28-20-10-8-17(13-25)9-11-20/h4-11,16H,12,14-15H2,1-3H3,(H2,26,29)(H2,27,28,32)/t24-/m1/s1 |
InChIKey | CTKHUQYUPSHMQE-XMMPIXPASA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | CC(C)C[C]1(C)NC(=N)N(Cc2ccc(CNC(=O)Nc3ccc(cc3)C#N)cc2)C1=O | OpenEye OEToolkits 1.7.0 | [H]/N=C\1/N[C@](C(=O)N1Cc2ccc(cc2)CNC(=O)Nc3ccc(cc3)C#N)(C)CC(C)C | CACTVS 3.352 | CC(C)C[C@@]1(C)NC(=N)N(Cc2ccc(CNC(=O)Nc3ccc(cc3)C#N)cc2)C1=O | OpenEye OEToolkits 1.7.0 | CC(C)CC1(C(=O)N(C(=N)N1)Cc2ccc(cc2)CNC(=O)Nc3ccc(cc3)C#N)C |
|
Formula | C24 H28 N6 O2 |
Name | 1-(4-cyanophenyl)-3-(4-{[(2Z,4R)-2-imino-4-methyl-4-(2-methylpropyl)-5-oxoimidazolidin-1-yl]methyl}benzyl)urea |
ChEMBL | |
DrugBank | |
ZINC | ZINC000045319614
|
PDB chain | 3l5c Chain B Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|