Structure of PDB 3hj0 Chain B Binding Site BS01 |
|
|
Ligand ID | A93 |
InChI | InChI=1S/C23H19FO3/c1-15-12-18(13-16(2)22(15)25)7-6-17-4-3-5-19(14-17)23(26)27-21-10-8-20(24)9-11-21/h3-14,25H,1-2H3/b7-6+ |
InChIKey | YDSMVVNYVJZDET-VOTSOKGWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | Cc1cc(/C=C/c2cccc(c2)C(=O)Oc3ccc(F)cc3)cc(C)c1O | OpenEye OEToolkits 1.5.0 | Cc1cc(cc(c1O)C)\C=C\c2cccc(c2)C(=O)Oc3ccc(cc3)F | OpenEye OEToolkits 1.5.0 | Cc1cc(cc(c1O)C)C=Cc2cccc(c2)C(=O)Oc3ccc(cc3)F | CACTVS 3.341 | Cc1cc(C=Cc2cccc(c2)C(=O)Oc3ccc(F)cc3)cc(C)c1O | ACDLabs 10.04 | Fc3ccc(OC(=O)c1cccc(c1)\C=C\c2cc(c(O)c(c2)C)C)cc3 |
|
Formula | C23 H19 F O3 |
Name | 4-fluorophenyl 3-[(E)-2-(4-hydroxy-3,5-dimethylphenyl)ethenyl]benzoate; (E)-4-fluorophenyl 3-(4-hydroxy-3,5-dimethylstyryl)benzoate |
ChEMBL | CHEMBL1213031 |
DrugBank | |
ZINC | ZINC000058564064
|
PDB chain | 3hj0 Chain B Residue 128
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|