Structure of PDB 3h2o Chain B Binding Site BS01 |
|
|
Ligand ID | B63 |
InChI | InChI=1S/C15H16N6O3/c16-15-20-12-11(13(22)21-15)19-10(7-18-12)5-6-17-9-3-1-8(2-4-9)14(23)24/h1-4,17H,5-7H2,(H,23,24)(H4,16,18,20,21,22) |
InChIKey | KCMJLKPNBXLNNJ-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | NC1=NC2=C(N=C(CCNc3ccc(cc3)C(O)=O)CN2)C(=O)N1 | ACDLabs 10.04 | O=C(O)c1ccc(cc1)NCCC2=NC=3C(=O)NC(=NC=3NC2)N | OpenEye OEToolkits 1.5.0 | c1cc(ccc1C(=O)O)NCCC2=NC3=C(NC2)N=C(NC3=O)N |
|
Formula | C15 H16 N6 O3 |
Name | 4-{[2-(2-amino-4-oxo-3,4,7,8-tetrahydropteridin-6-yl)ethyl]amino}benzoic acid |
ChEMBL | CHEMBL566065 |
DrugBank | |
ZINC | ZINC000004823107
|
PDB chain | 3h2o Chain B Residue 502
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|