Structure of PDB 3h2n Chain B Binding Site BS01 |
|
|
Ligand ID | B62 |
InChI | InChI=1S/C7H11N5O/c1-3-2-9-5-4(10-3)6(13)12-7(8)11-5/h3,10H,2H2,1H3,(H4,8,9,11,12,13)/t3-/m1/s1 |
InChIKey | HWOZEJJVUCALGB-GSVOUGTGSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC1CNC2=C(N1)C(=O)NC(=N2)N | CACTVS 3.341 OpenEye OEToolkits 1.5.0 | C[C@@H]1CNC2=C(N1)C(=O)NC(=N2)N | ACDLabs 10.04 | O=C1C=2NC(CNC=2N=C(N1)N)C | CACTVS 3.341 | C[CH]1CNC2=C(N1)C(=O)NC(=N2)N |
|
Formula | C7 H11 N5 O |
Name | (6R)-2-amino-6-methyl-5,6,7,8-tetrahydropteridin-4(3H)-one |
ChEMBL | |
DrugBank | |
ZINC | ZINC000013508949
|
PDB chain | 3h2n Chain B Residue 902
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|