Structure of PDB 3h2e Chain B Binding Site BS01 |
|
|
Ligand ID | B59 |
InChI | InChI=1S/C9H8N4O4/c1-12-6-5(8(16)13(2)9(12)17)10-4(3-14)7(15)11-6/h3H,1-2H3,(H,11,15) |
InChIKey | LVJCGSZYPTZSMO-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CN1C2=C(C(=O)N(C1=O)C)N=C(C(=O)N2)C=O | CACTVS 3.341 | CN1C(=O)N(C)C2=C(N=C(C=O)C(=O)N2)C1=O | ACDLabs 10.04 | O=C1N(C(=O)N(C=2NC(=O)C(=NC1=2)C=O)C)C |
|
Formula | C9 H8 N4 O4 |
Name | 1,3-dimethyl-2,4,7-trioxo-1,2,3,4,7,8-hexahydropteridine-6-carbaldehyde |
ChEMBL | CHEMBL567562 |
DrugBank | |
ZINC | ZINC000100713968
|
PDB chain | 3h2e Chain B Residue 901
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|