Structure of PDB 3h26 Chain B Binding Site BS01 |
|
|
Ligand ID | B56 |
InChI | InChI=1S/C8H9N5O3/c1-13-2-3(7(15)16)10-4-5(13)11-8(9)12-6(4)14/h2H2,1H3,(H,15,16)(H3,9,11,12,14) |
InChIKey | LLLLJZKILITAII-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=C1NC(=NC=2N(CC(=NC1=2)C(=O)O)C)N | OpenEye OEToolkits 1.5.0 | CN1CC(=NC2=C1N=C(NC2=O)N)C(=O)O | CACTVS 3.341 | CN1CC(=NC2=C1N=C(N)NC2=O)C(O)=O |
|
Formula | C8 H9 N5 O3 |
Name | 2-amino-8-methyl-4-oxo-3,4,7,8-tetrahydropteridine-6-carboxylic acid |
ChEMBL | CHEMBL577547 |
DrugBank | |
ZINC | ZINC000005502659
|
PDB chain | 3h26 Chain B Residue 902
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|