Structure of PDB 3ga5 Chain B Binding Site BS01 |
|
|
Ligand ID | RGG |
InChI | InChI=1S/C9H18O8/c10-1-4(12)3-16-9-8(15)7(14)6(13)5(2-11)17-9/h4-15H,1-3H2/t4-,5-,6+,7+,8-,9-/m1/s1 |
InChIKey | NHJUPBDCSOGIKX-NTXXKDEISA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | OC[CH](O)CO[CH]1O[CH](CO)[CH](O)[CH](O)[CH]1O | OpenEye OEToolkits 1.5.0 | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)OC[C@@H](CO)O)O)O)O)O | ACDLabs 10.04 | O(CC(O)CO)C1OC(C(O)C(O)C1O)CO | OpenEye OEToolkits 1.5.0 | C(C1C(C(C(C(O1)OCC(CO)O)O)O)O)O | CACTVS 3.341 | OC[C@@H](O)CO[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
|
Formula | C9 H18 O8 |
Name | (2R)-2,3-dihydroxypropyl beta-D-galactopyranoside; (2R)-glyceryl-beta-D-galactopyranoside; (2R)-2,3-dihydroxypropyl beta-D-galactoside; (2R)-2,3-dihydroxypropyl D-galactoside; (2R)-2,3-dihydroxypropyl galactoside |
ChEMBL | CHEMBL446492 |
DrugBank | |
ZINC | ZINC000004096297
|
PDB chain | 3ga5 Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|