Structure of PDB 3g8o Chain B Binding Site BS01 |
|
|
Ligand ID | 30X |
InChI | InChI=1S/C15H15F6N3O/c1-9(13(25)23(2)3)24(8-14(16,17)18)11-5-4-10(7-22)12(6-11)15(19,20)21/h4-6,9H,8H2,1-3H3/t9-/m0/s1 |
InChIKey | BEFAEFLFXOZVJY-VIFPVBQESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | CC(C(=O)N(C)C)N(CC(F)(F)F)c1ccc(c(c1)C(F)(F)F)C#N | CACTVS 3.341 | C[C@H](N(CC(F)(F)F)c1ccc(C#N)c(c1)C(F)(F)F)C(=O)N(C)C | ACDLabs 10.04 | O=C(N(C)C)C(N(c1cc(c(C#N)cc1)C(F)(F)F)CC(F)(F)F)C | OpenEye OEToolkits 1.5.0 | C[C@@H](C(=O)N(C)C)[N@@](CC(F)(F)F)c1ccc(c(c1)C(F)(F)F)C#N | CACTVS 3.341 | C[CH](N(CC(F)(F)F)c1ccc(C#N)c(c1)C(F)(F)F)C(=O)N(C)C |
|
Formula | C15 H15 F6 N3 O |
Name | N~2~-[4-cyano-3-(trifluoromethyl)phenyl]-N,N-dimethyl-N~2~-(2,2,2-trifluoroethyl)-L-alaninamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000043020005
|
PDB chain | 3g8o Chain B Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|