Structure of PDB 3fqh Chain B Binding Site BS01 |
|
|
Ligand ID | 057 |
InChI | InChI=1S/C21H22N4O2/c1-21(2,12-26)24-20(27)14-6-7-18-15(9-14)16(11-25(18)3)17-10-13-5-4-8-22-19(13)23-17/h4-11,26H,12H2,1-3H3,(H,22,23)(H,24,27) |
InChIKey | XZRYCTLOGNCQDG-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | Cn1cc(c2[nH]c3ncccc3c2)c4cc(ccc14)C(=O)NC(C)(C)CO | OpenEye OEToolkits 1.5.0 | CC(C)(CO)NC(=O)c1ccc2c(c1)c(cn2C)c3cc4cccnc4[nH]3 | ACDLabs 10.04 | O=C(c1cc2c(cc1)n(cc2c4cc3cccnc3n4)C)NC(C)(C)CO |
|
Formula | C21 H22 N4 O2 |
Name | N-(2-hydroxy-1,1-dimethylethyl)-1-methyl-3-(1H-pyrrolo[2,3-b]pyridin-2-yl)-1H-indole-5-carboxamide |
ChEMBL | CHEMBL1229525 |
DrugBank | DB06834 |
ZINC | ZINC000034055334
|
PDB chain | 3fqh Chain B Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|