Structure of PDB 3fcl Chain B Binding Site BS01 |
|
|
Ligand ID | 3FL |
InChI | InChI=1S/C17H22N4O4/c22-15-9-14(20-17(25)21-15)11-19-7-2-1-6-18-10-12-4-3-5-13(8-12)16(23)24/h3-5,8-9,18-19H,1-2,6-7,10-11H2,(H,23,24)(H2,20,21,22,25) |
InChIKey | PLKKHOGCWCJFJX-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1cc(cc(c1)C(=O)O)CNCCCCNCC2=CC(=O)NC(=O)N2 | ACDLabs 10.04 | O=C1NC(=CC(=O)N1)CNCCCCNCc2cc(C(=O)O)ccc2 | CACTVS 3.341 | OC(=O)c1cccc(CNCCCCNCC2=CC(=O)NC(=O)N2)c1 |
|
Formula | C17 H22 N4 O4 |
Name | 3-{[(4-{[(2,6-dioxo-1,2,3,6-tetrahydropyrimidin-4-yl)methyl]amino}butyl)amino]methyl}benzoic acid |
ChEMBL | CHEMBL1213373 |
DrugBank | |
ZINC | ZINC000058583506
|
PDB chain | 3fcl Chain A Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|