Structure of PDB 3fa6 Chain B Binding Site BS01 |
|
|
Ligand ID | LSR |
InChI | InChI=1S/C15H24/c1-6-12(2)9-10-14-13(3)8-7-11-15(14,4)5/h6,9-10H,7-8,11H2,1-5H3/b10-9+,12-6+ |
InChIKey | KUEVAPFABUUVHS-AYCKBHPDSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C\C=C(/C)\C=C\C1=C(CCCC1(C)C)C | CACTVS 3.341 | C\C=C(C)\C=C\C1=C(C)CCCC1(C)C | CACTVS 3.341 | CC=C(C)C=CC1=C(C)CCCC1(C)C | OpenEye OEToolkits 1.5.0 | CC=C(C)C=CC1=C(CCCC1(C)C)C | ACDLabs 10.04 | C(/C1=C(CCCC1(C)C)C)=C\C(=C\C)C |
|
Formula | C15 H24 |
Name | 1,3,3-trimethyl-2-[(1E,3E)-3-methylpenta-1,3-dien-1-yl]cyclohexene |
ChEMBL | |
DrugBank | DB08127 |
ZINC | ZINC000058639152
|
PDB chain | 3fa6 Chain B Residue 138
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|