Structure of PDB 3ei9 Chain B Binding Site BS01 |
|
|
Ligand ID | PL6 |
InChI | InChI=1S/C13H17N2O9P/c1-7-12(18)9(8(4-14-7)6-24-25(21,22)23)5-15-10(13(19)20)2-3-11(16)17/h4-5,10,18H,2-3,6H2,1H3,(H,16,17)(H,19,20)(H2,21,22,23)/b15-5+/t10-/m0/s1 |
InChIKey | ZZRWFCMLYWHYGX-XSFFOXFNSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | Cc1ncc(CO[P](O)(O)=O)c(C=N[C@@H](CCC(O)=O)C(O)=O)c1O | OpenEye OEToolkits 1.5.0 | Cc1c(c(c(cn1)COP(=O)(O)O)C=NC(CCC(=O)O)C(=O)O)O | OpenEye OEToolkits 1.5.0 | Cc1c(c(c(cn1)COP(=O)(O)O)\C=N\[C@@H](CCC(=O)O)C(=O)O)O | ACDLabs 10.04 | O=C(O)C(/N=C/c1c(cnc(c1O)C)COP(=O)(O)O)CCC(=O)O | CACTVS 3.341 | Cc1ncc(CO[P](O)(O)=O)c(C=N[CH](CCC(O)=O)C(O)=O)c1O |
|
Formula | C13 H17 N2 O9 P |
Name | (E)-N-({3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}methylidene)-L-glutamic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058651782
|
PDB chain | 3ei9 Chain A Residue 433
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
2.6.1.83: LL-diaminopimelate aminotransferase. |
|
|
|