Structure of PDB 3djf Chain B Binding Site BS01 |
|
|
Ligand ID | BC3 |
InChI | InChI=1S/C12H11N5O/c13-12-16-9-8(4-7-2-1-3-14-5-7)6-15-10(9)11(18)17-12/h1-3,5-6,15H,4H2,(H3,13,16,17,18) |
InChIKey | DOHVAKFYAHLCJP-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1cc(cnc1)Cc2c[nH]c3c2N=C(NC3=O)N | CACTVS 3.341 | NC1=Nc2c(Cc3cccnc3)c[nH]c2C(=O)N1 | ACDLabs 10.04 | O=C1c2c(N=C(N1)N)c(cn2)Cc3cccnc3 |
|
Formula | C12 H11 N5 O |
Name | 2-amino-7-(pyridin-3-ylmethyl)-3,5-dihydro-4H-pyrrolo[3,2-d]pyrimidin-4-one; peldesine,BCX-34 |
ChEMBL | CHEMBL311300 |
DrugBank | DB02568 |
ZINC | ZINC000005420970
|
PDB chain | 3djf Chain B Residue 289
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|