Structure of PDB 3d0e Chain B Binding Site BS01 |
|
|
Ligand ID | G93 |
InChI | InChI=1S/C21H27N7O3/c1-4-28-18-15(30-12-13-6-5-9-23-10-13)11-24-14(7-8-21(2,3)29)16(18)25-20(28)17-19(22)27-31-26-17/h11,13,23,29H,4-6,9-10,12H2,1-3H3,(H2,22,27)/t13-/m0/s1 |
InChIKey | KGPGFQWBCSZGEL-ZDUSSCGKSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | CCn1c(nc2c(ncc(OC[C@H]3CCCNC3)c12)C#CC(C)(C)O)c4nonc4N | CACTVS 3.370 | CCn1c(nc2c(ncc(OC[CH]3CCCNC3)c12)C#CC(C)(C)O)c4nonc4N | ACDLabs 12.01 | n1onc(N)c1c2nc4c(n2CC)c(OCC3CCCNC3)cnc4C#CC(O)(C)C | OpenEye OEToolkits 1.7.0 | CCn1c2c(cnc(c2nc1c3c(non3)N)C#CC(C)(C)O)OCC4CCCNC4 | OpenEye OEToolkits 1.7.0 | CCn1c2c(cnc(c2nc1c3c(non3)N)C#CC(C)(C)O)OC[C@H]4CCCNC4 |
|
Formula | C21 H27 N7 O3 |
Name | 4-{2-(4-amino-1,2,5-oxadiazol-3-yl)-1-ethyl-7-[(3S)-piperidin-3-ylmethoxy]-1H-imidazo[4,5-c]pyridin-4-yl}-2-methylbut-3 -yn-2-ol; GSK690693 |
ChEMBL | CHEMBL494089 |
DrugBank | DB12745 |
ZINC | ZINC000034285211
|
PDB chain | 3d0e Chain B Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|