Structure of PDB 3chc Chain B Binding Site BS01 |
|
|
Ligand ID | ZRG |
InChI | InChI=1S/C11H22N6O3/c1-7(18)16-8(9(19)13-2)5-4-6-15-10(12)17-11(20)14-3/h8H,4-6H2,1-3H3,(H,13,19)(H,16,18)(H4,12,14,15,17,20)/t8-/m0/s1 |
InChIKey | IHUKVJKKTBLTEE-QMMMGPOBSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | [H]/N=C(/NCCC[C@@H](C(=O)NC)NC(=O)C)\NC(=O)NC | OpenEye OEToolkits 1.7.0 | CC(=O)NC(CCCNC(=N)NC(=O)NC)C(=O)NC | ACDLabs 12.01 | O=C(NC)C(NC(=O)C)CCCNC(=[N@H])NC(=O)NC | CACTVS 3.370 | CNC(=O)NC(=N)NCCC[CH](NC(C)=O)C(=O)NC | CACTVS 3.370 | CNC(=O)NC(=N)NCCC[C@H](NC(C)=O)C(=O)NC |
|
Formula | C11 H22 N6 O3 |
Name | (2S)-2-acetamido-N-methyl-5-[[N-(methylcarbamoyl)carbamimidoyl]amino]pentanamide |
ChEMBL | |
DrugBank | |
ZINC | ZINC000024974824
|
PDB chain | 3chc Chain B Residue 440
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|