Structure of PDB 3bqn Chain B Binding Site BS01 |
|
|
Ligand ID | BQN |
InChI | InChI=1S/C27H22F6N2O3S/c28-26(29,30)24-19(8-10-23(36)35-12-14-37-15-13-35)7-9-22(25(24)27(31,32)33)39-21-6-2-1-5-20(21)38-17-18-4-3-11-34-16-18/h1-11,16H,12-15,17H2/b10-8+ |
InChIKey | ZRIKDHLPCRURPX-CSKARUKUSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | FC(F)(F)c1c(Sc2ccccc2OCc3cccnc3)ccc(C=CC(=O)N4CCOCC4)c1C(F)(F)F | OpenEye OEToolkits 1.5.0 | c1ccc(c(c1)OCc2cccnc2)Sc3ccc(c(c3C(F)(F)F)C(F)(F)F)C=CC(=O)N4CCOCC4 | CACTVS 3.341 | FC(F)(F)c1c(Sc2ccccc2OCc3cccnc3)ccc(\C=C\C(=O)N4CCOCC4)c1C(F)(F)F | OpenEye OEToolkits 1.5.0 | c1ccc(c(c1)OCc2cccnc2)Sc3ccc(c(c3C(F)(F)F)C(F)(F)F)\C=C\C(=O)N4CCOCC4 | ACDLabs 10.04 | O=C(\C=C\c3ccc(Sc2ccccc2OCc1cccnc1)c(c3C(F)(F)F)C(F)(F)F)N4CCOCC4 |
|
Formula | C27 H22 F6 N2 O3 S |
Name | 4-{(2E)-3-[4-{[2-(pyridin-3-ylmethoxy)phenyl]sulfanyl}-2,3-bis(trifluoromethyl)phenyl]prop-2-enoyl}morpholine |
ChEMBL | CHEMBL487705 |
DrugBank | |
ZINC | ZINC000039046720
|
PDB chain | 3bqn Chain B Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|