Structure of PDB 3bki Chain B Binding Site BS01 |
|
|
Ligand ID | FQX |
InChI | InChI=1S/C8H4N4O4/c13-7-8(14)10-4-2-6-5(1-3(4)9-7)11-16-12(6)15/h1-2H,(H,9,13)(H,10,14) |
InChIKey | GBLOKWQVACPFGV-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1c2c(cc3c1NC(=O)C(=O)N3)[n+](on2)[O-] | CACTVS 3.341 | [O-][n+]1onc2cc3NC(=O)C(=O)Nc3cc12 | ACDLabs 10.04 | [O-][n+]3onc2c3cc1NC(=O)C(=O)Nc1c2 |
|
Formula | C8 H4 N4 O4 |
Name | [1,2,5]oxadiazolo[3,4-g]quinoxaline-6,7(5H,8H)-dione 1-oxide |
ChEMBL | CHEMBL462490 |
DrugBank | |
ZINC | ZINC000000023110
|
PDB chain | 3bki Chain B Residue 264
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|