Structure of PDB 3b1n Chain B Binding Site BS01 |
|
|
Ligand ID | MZR |
InChI | InChI=1S/C9H13N3O6/c10-7(16)4-8(17)12(2-11-4)9-6(15)5(14)3(1-13)18-9/h2-3,5-6,9,13-15,17H,1H2,(H2,10,16)/t3-,5-,6-,9-/m1/s1 |
InChIKey | HZQDCMWJEBCWBR-UUOKFMHZSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O=C(c1ncn(c1O)C2OC(C(O)C2O)CO)N | CACTVS 3.370 | NC(=O)c1ncn([CH]2O[CH](CO)[CH](O)[CH]2O)c1O | OpenEye OEToolkits 1.7.2 | c1nc(c(n1C2C(C(C(O2)CO)O)O)O)C(=O)N | CACTVS 3.370 | NC(=O)c1ncn([C@@H]2O[C@H](CO)[C@@H](O)[C@H]2O)c1O | OpenEye OEToolkits 1.7.2 | c1nc(c(n1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)O)C(=O)N |
|
Formula | C9 H13 N3 O6 |
Name | 5-hydroxy-1-(beta-D-ribofuranosyl)-1H-imidazole-4-carboxamide; Mizoribine |
ChEMBL | CHEMBL245019 |
DrugBank | DB12617 |
ZINC | ZINC000003812887
|
PDB chain | 3b1n Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|