Structure of PDB 3ant Chain B Binding Site BS01 |
|
|
Ligand ID | S82 |
InChI | InChI=1S/C20H26N4O2/c1-13(2)18-22-19(26-23-18)15-8-10-24(11-9-15)20(25)21-17-12-16(17)14-6-4-3-5-7-14/h3-7,13,15-17H,8-12H2,1-2H3,(H,21,25)/t16-,17+/m1/s1 |
InChIKey | WYQYSMZPAAVISB-SJORKVTESA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | CC(C)c1nc(on1)C2CCN(CC2)C(=O)NC3CC3c4ccccc4 | CACTVS 3.370 | CC(C)c1noc(n1)[CH]2CCN(CC2)C(=O)N[CH]3C[CH]3c4ccccc4 | CACTVS 3.370 | CC(C)c1noc(n1)[C@H]2CCN(CC2)C(=O)N[C@H]3C[C@@H]3c4ccccc4 | ACDLabs 12.01 | O=C(NC2CC2c1ccccc1)N4CCC(c3nc(no3)C(C)C)CC4 | OpenEye OEToolkits 1.7.0 | CC(C)c1nc(on1)C2CCN(CC2)C(=O)N[C@H]3C[C@@H]3c4ccccc4 |
|
Formula | C20 H26 N4 O2 |
Name | 4-[3-(1-methylethyl)-1,2,4-oxadiazol-5-yl]-N-[(1S,2R)-2-phenylcyclopropyl]piperidine-1-carboxamide |
ChEMBL | CHEMBL1615216 |
DrugBank | |
ZINC | ZINC000064746663
|
PDB chain | 3ant Chain B Residue 602
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|