Structure of PDB 3aex Chain B Binding Site BS01 |
|
|
Ligand ID | AN7 |
InChI | InChI=1S/C11H12NO8P/c1-6-10(14)8(2-3-9(13)11(15)16)7(4-12-6)5-20-21(17,18)19/h2-4,14H,5H2,1H3,(H,15,16)(H2,17,18,19)/b3-2+ |
InChIKey | FYMYHYJKCICXRI-NSCUHMNNSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.370 | Cc1ncc(CO[P](O)(O)=O)c(C=CC(=O)C(O)=O)c1O | ACDLabs 12.01 | O=C(O)C(=O)\C=C\c1c(cnc(c1O)C)COP(=O)(O)O | OpenEye OEToolkits 1.7.0 | Cc1c(c(c(cn1)COP(=O)(O)O)/C=C/C(=O)C(=O)O)O | OpenEye OEToolkits 1.7.0 | Cc1c(c(c(cn1)COP(=O)(O)O)C=CC(=O)C(=O)O)O | CACTVS 3.370 | Cc1ncc(CO[P](O)(O)=O)c(/C=C/C(=O)C(O)=O)c1O |
|
Formula | C11 H12 N O8 P |
Name | (3E)-4-{3-hydroxy-2-methyl-5-[(phosphonooxy)methyl]pyridin-4-yl}-2-oxobut-3-enoic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000058631618
|
PDB chain | 3aex Chain B Residue 1002
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|