Structure of PDB 2ydj Chain B Binding Site BS01 |
|
|
Ligand ID | YDJ |
InChI | InChI=1S/C17H19FN4O2S/c18-11-4-1-3-10(7-11)14-8-13(22-17(19)24)15(25-14)16(23)21-12-5-2-6-20-9-12/h1,3-4,7-8,12,20H,2,5-6,9H2,(H,21,23)(H3,19,22,24)/t12-/m0/s1 |
InChIKey | IAYGCINLNONXHY-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.0 | c1cc(cc(c1)F)c2cc(c(s2)C(=O)N[C@H]3CCCNC3)NC(=O)N | OpenEye OEToolkits 1.7.0 | c1cc(cc(c1)F)c2cc(c(s2)C(=O)NC3CCCNC3)NC(=O)N | CACTVS 3.370 | NC(=O)Nc1cc(sc1C(=O)N[CH]2CCCNC2)c3cccc(F)c3 | CACTVS 3.370 | NC(=O)Nc1cc(sc1C(=O)N[C@H]2CCCNC2)c3cccc(F)c3 | ACDLabs 12.01 | O=C(c1sc(cc1NC(=O)N)c2cccc(F)c2)NC3CCCNC3 |
|
Formula | C17 H19 F N4 O2 S |
Name | 5-(3-fluorophenyl)-N-[(3S)-3-piperidyl]-3-ureido-thiophene-2-carboxamide |
ChEMBL | CHEMBL2041933 |
DrugBank | DB12242 |
ZINC | ZINC000033359230
|
PDB chain | 2ydj Chain B Residue 1270
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|