Structure of PDB 2y8c Chain B Binding Site BS01 |
|
|
Ligand ID | DUQ |
InChI | InChI=1S/C30H31N3O5/c34-20-18-31-28(36)23(22-33-19-16-27(35)32-29(33)37)17-21-38-30(24-10-4-1-5-11-24,25-12-6-2-7-13-25)26-14-8-3-9-15-26/h1-16,19,23,34H,17-18,20-22H2,(H,31,36)(H,32,35,37)/t23-/m0/s1 |
InChIKey | POOIRAMVDDLAIT-QHCPKHFHSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.352 | OCCNC(=O)[CH](CCOC(c1ccccc1)(c2ccccc2)c3ccccc3)CN4C=CC(=O)NC4=O | OpenEye OEToolkits 1.6.1 | c1ccc(cc1)C(c2ccccc2)(c3ccccc3)OCC[C@@H](CN4C=CC(=O)NC4=O)C(=O)NCCO | OpenEye OEToolkits 1.6.1 | c1ccc(cc1)C(c2ccccc2)(c3ccccc3)OCCC(CN4C=CC(=O)NC4=O)C(=O)NCCO | CACTVS 3.352 | OCCNC(=O)[C@@H](CCOC(c1ccccc1)(c2ccccc2)c3ccccc3)CN4C=CC(=O)NC4=O |
|
Formula | C30 H31 N3 O5 |
Name | (2S)-2-[(2,4-dioxopyrimidin-1-yl)methyl]-N-(2-hydroxyethyl)-4-trityloxy-butanamide; 5'-TRITYLATED DEOXYURIDINE ANALOGUE |
ChEMBL | |
DrugBank | |
ZINC | ZINC000071316960
|
PDB chain | 2y8c Chain B Residue 400
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|