Structure of PDB 2xzk Chain B Binding Site BS01 |
|
|
Ligand ID | FKD |
InChI | InChI=1S/C9H15FO9/c10-7-5(15)4(14)6(3(13)2(12)1-11)19-9(7,18)8(16)17/h2-7,11-15,18H,1H2,(H,16,17)/t2-,3-,4-,5-,6+,7-,9+/m1/s1 |
InChIKey | KOWJBKIDVGQXJZ-QMFVTVPYSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.7.6 | C(C(C(C1C(C(C(C(O1)(C(=O)O)O)F)O)O)O)O)O | CACTVS 3.370 | OC[C@@H](O)[C@@H](O)[C@@H]1O[C@@](O)([C@H](F)[C@H](O)[C@H]1O)C(O)=O | ACDLabs 12.01 | O=C(O)C1(O)OC(C(O)C(O)C1F)C(O)C(O)CO | OpenEye OEToolkits 1.7.6 | C([C@H]([C@H]([C@H]1[C@@H]([C@H]([C@H]([C@](O1)(C(=O)O)O)F)O)O)O)O)O | CACTVS 3.370 | OC[CH](O)[CH](O)[CH]1O[C](O)([CH](F)[CH](O)[CH]1O)C(O)=O |
|
Formula | C9 H15 F O9 |
Name | 3-deoxy-3-fluoro-D-erythro-alpha-L-manno-non-2-ulopyranosonic acid; 3-deoxy-3-fluoro-D-erythro-alpha-L-manno-non-2-ulosonic acid; 3-deoxy-3-fluoro-D-erythro-L-manno-non-2-ulosonic acid; 3-deoxy-3-fluoro-D-erythro-manno-non-2-ulosonic acid |
ChEMBL | |
DrugBank | DB04694 |
ZINC | ZINC000033836617
|
PDB chain | 2xzk Chain B Residue 500
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
3.2.1.18: exo-alpha-sialidase. |
|
|
|