Structure of PDB 2xkw Chain B Binding Site BS01 |
|
|
Ligand ID | P1B |
InChI | InChI=1S/C19H20N2O3S/c1-2-13-3-6-15(20-12-13)9-10-24-16-7-4-14(5-8-16)11-17-18(22)21-19(23)25-17/h3-8,12,17H,2,9-11H2,1H3,(H,21,22,23)/t17-/m1/s1 |
InChIKey | HYAFETHFCAUJAY-QGZVFWFLSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.6.1 | CCc1ccc(nc1)CCOc2ccc(cc2)C[C@@H]3C(=O)NC(=O)S3 | CACTVS 3.352 | CCc1ccc(CCOc2ccc(C[C@H]3SC(=O)NC3=O)cc2)nc1 | ACDLabs 10.04 | O=C1NC(=O)SC1Cc3ccc(OCCc2ncc(cc2)CC)cc3 | OpenEye OEToolkits 1.6.1 | CCc1ccc(nc1)CCOc2ccc(cc2)CC3C(=O)NC(=O)S3 | CACTVS 3.352 | CCc1ccc(CCOc2ccc(C[CH]3SC(=O)NC3=O)cc2)nc1 |
|
Formula | C19 H20 N2 O3 S |
Name | (5R)-5-{4-[2-(5-ethylpyridin-2-yl)ethoxy]benzyl}-1,3-thiazolidine-2,4-dione; PIOGLITAZONE |
ChEMBL | |
DrugBank | |
ZINC | ZINC000000968327
|
PDB chain | 2xkw Chain B Residue 1475
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|