Structure of PDB 2vu2 Chain B Binding Site BS01 |
|
|
Ligand ID | PN5 |
InChI | InChI=1S/C16H30N2O5S/c1-15(2,3)14(22)23-10-16(4,5)12(20)13(21)18-7-6-11(19)17-8-9-24/h12,20,24H,6-10H2,1-5H3,(H,17,19)(H,18,21)/t12-/m0/s1 |
InChIKey | KVQSHCZSRKQWCB-LBPRGKRZSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CC(C)(C)C(=O)OCC(C)(C)[C@@H](O)C(=O)NCCC(=O)NCCS | CACTVS 3.341 | CC(C)(C)C(=O)OCC(C)(C)[CH](O)C(=O)NCCC(=O)NCCS | ACDLabs 10.04 | O=C(NCCS)CCNC(=O)C(O)C(C)(C)COC(=O)C(C)(C)C | OpenEye OEToolkits 1.5.0 | CC(C)(C)C(=O)OCC(C)(C)C(C(=O)NCCC(=O)NCCS)O | OpenEye OEToolkits 1.5.0 | CC(C)(C)C(=O)OCC(C)(C)[C@H](C(=O)NCCC(=O)NCCS)O |
|
Formula | C16 H30 N2 O5 S |
Name | (3R)-3-hydroxy-2,2-dimethyl-4-oxo-4-({3-oxo-3-[(2-sulfanylethyl)amino]propyl}amino)butyl 2,2-dimethylpropanoate |
ChEMBL | |
DrugBank | DB08408 |
ZINC | ZINC000013522155
|
PDB chain | 2vu2 Chain B Residue 1393
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|