Structure of PDB 2r9w Chain B Binding Site BS01 |
|
|
Ligand ID | 23C |
InChI | InChI=1S/C22H15NO6/c24-19-16-9-8-14(21(26)27)10-17(16)20(25)23(19)18(22(28)29)11-13-6-3-5-12-4-1-2-7-15(12)13/h1-10,18H,11H2,(H,26,27)(H,28,29)/t18-/m1/s1 |
InChIKey | CZNPWASYMRBJCX-GOSISDBHSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | c1ccc2c(c1)cccc2CC(C(=O)O)N3C(=O)c4ccc(cc4C3=O)C(=O)O | ACDLabs 10.04 | O=C(O)C(N2C(=O)c1ccc(cc1C2=O)C(=O)O)Cc4c3ccccc3ccc4 | OpenEye OEToolkits 1.5.0 | c1ccc2c(c1)cccc2C[C@H](C(=O)O)N3C(=O)c4ccc(cc4C3=O)C(=O)O | CACTVS 3.341 | OC(=O)[CH](Cc1cccc2ccccc12)N3C(=O)c4ccc(cc4C3=O)C(O)=O | CACTVS 3.341 | OC(=O)[C@@H](Cc1cccc2ccccc12)N3C(=O)c4ccc(cc4C3=O)C(O)=O |
|
Formula | C22 H15 N O6 |
Name | 2-[(1R)-1-carboxy-2-naphthalen-1-ylethyl]-1,3-dioxo-2,3-dihydro-1H-isoindole-5-carboxylic acid |
ChEMBL | CHEMBL405886 |
DrugBank | DB06922 |
ZINC |
|
PDB chain | 2r9w Chain B Residue 2
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|