Structure of PDB 2r1w Chain B Binding Site BS01 |
|
|
Ligand ID | KDA |
InChI | InChI=1S/C11H18O8/c1-2-3-18-11(10(16)17)4-6(13)8(15)9(19-11)7(14)5-12/h2,6-9,12-15H,1,3-5H2,(H,16,17)/t6-,7-,8-,9-,11-/m1/s1 |
InChIKey | LEEKAQBTVJRLOA-UEWQFTGXSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | OC[C@@H](O)[C@H]1O[C@@](C[C@@H](O)[C@H]1O)(OCC=C)C(O)=O | ACDLabs 10.04 | O=C(O)C1(OC\C=C)OC(C(O)CO)C(O)C(O)C1 | OpenEye OEToolkits 1.5.0 | C=CCOC1(CC(C(C(O1)C(CO)O)O)O)C(=O)O | OpenEye OEToolkits 1.5.0 | C=CCO[C@@]1(C[C@H]([C@H]([C@H](O1)[C@@H](CO)O)O)O)C(=O)O | CACTVS 3.341 | OC[CH](O)[CH]1O[C](C[CH](O)[CH]1O)(OCC=C)C(O)=O |
|
Formula | C11 H18 O8 |
Name | prop-2-en-1-yl 3-deoxy-alpha-D-manno-oct-2-ulopyranosidonic acid; (3-DEOXY-D-MANNO-OCT-2-ULOSONIC ACID)-2-O-ALLYL; prop-2-en-1-yl 3-deoxy-alpha-D-manno-oct-2-ulosidonic acid; prop-2-en-1-yl 3-deoxy-D-manno-oct-2-ulosidonic acid; prop-2-en-1-yl 3-deoxy-manno-oct-2-ulosidonic acid |
ChEMBL | |
DrugBank | |
ZINC | ZINC000005852687
|
PDB chain | 2r1w Chain C Residue 1
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|