Structure of PDB 2jjk Chain B Binding Site BS01 |
|
|
Ligand ID | R15 |
InChI | InChI=1S/C21H26Cl2N4O6S2/c22-16-8-6-10-18(14-16)34(30,31)26-20(28)24-12-4-2-1-3-5-13-25-21(29)27-35(32,33)19-11-7-9-17(23)15-19/h6-11,14-15H,1-5,12-13H2,(H2,24,26,28)(H2,25,27,29) |
InChIKey | WYYQITAYQRQOJA-UHFFFAOYSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | O=S(=O)(c1cc(Cl)ccc1)NC(=O)NCCCCCCCNC(=O)NS(=O)(=O)c2cccc(Cl)c2 | CACTVS 3.341 | Clc1cccc(c1)[S](=O)(=O)NC(=O)NCCCCCCCNC(=O)N[S](=O)(=O)c2cccc(Cl)c2 | OpenEye OEToolkits 1.5.0 | c1cc(cc(c1)Cl)S(=O)(=O)NC(=O)NCCCCCCCNC(=O)NS(=O)(=O)c2cccc(c2)Cl |
|
Formula | C21 H26 Cl2 N4 O6 S2 |
Name | N,N'-(heptane-1,7-diyldicarbamoyl)bis(3-chlorobenzenesulfonamide) |
ChEMBL | CHEMBL457189 |
DrugBank | |
ZINC | ZINC000038558761
|
PDB chain | 2jjk Chain D Residue 1336
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|