Structure of PDB 2ab6 Chain B Binding Site BS01 |
|
|
Ligand ID | GSM |
InChI | InChI=1S/C11H19N3O6S/c1-21-5-7(10(18)13-4-9(16)17)14-8(15)3-2-6(12)11(19)20/h6-7H,2-5,12H2,1H3,(H,13,18)(H,14,15)(H,16,17)(H,19,20)/t6-,7-/m0/s1 |
InChIKey | QTQDDTSVRVWHMO-BQBZGAKWSA-N |
SMILES | Software | SMILES |
---|
CACTVS 3.341 | CSC[C@H](NC(=O)CC[C@H](N)C(O)=O)C(=O)NCC(O)=O | CACTVS 3.341 | CSC[CH](NC(=O)CC[CH](N)C(O)=O)C(=O)NCC(O)=O | OpenEye OEToolkits 1.5.0 | CSC[C@@H](C(=O)NCC(=O)O)NC(=O)CC[C@@H](C(=O)O)N | ACDLabs 10.04 | O=C(NCC(=O)O)C(NC(=O)CCC(C(=O)O)N)CSC | OpenEye OEToolkits 1.5.0 | CSCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N |
|
Formula | C11 H19 N3 O6 S |
Name | L-GAMMA-GLUTAMYL-S-METHYLCYSTEINYLGLYCINE; S-METHYL-GLUTATHIONE |
ChEMBL | CHEMBL1233129 |
DrugBank | DB04701 |
ZINC | ZINC000001532230
|
PDB chain | 2ab6 Chain B Residue 2218
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Catalytic site (original residue number in PDB) |
Y6 L12 R17 |
Catalytic site (residue number reindexed from 1) |
Y6 L12 R17 |
Enzyme Commision number |
2.5.1.18: glutathione transferase. |
|
|
Biological Process |
GO:0006629 |
lipid metabolic process |
GO:0006749 |
glutathione metabolic process |
GO:0010880 |
regulation of release of sequestered calcium ion into cytosol by sarcoplasmic reticulum |
GO:0010881 |
regulation of cardiac muscle contraction by regulation of the release of sequestered calcium ion |
GO:0014809 |
regulation of skeletal muscle contraction by regulation of release of sequestered calcium ion |
GO:0018916 |
nitrobenzene metabolic process |
GO:0042178 |
xenobiotic catabolic process |
GO:0043651 |
linoleic acid metabolic process |
GO:0051122 |
hepoxilin biosynthetic process |
GO:0055119 |
relaxation of cardiac muscle |
GO:0060315 |
negative regulation of ryanodine-sensitive calcium-release channel activity |
GO:0060316 |
positive regulation of ryanodine-sensitive calcium-release channel activity |
GO:0070458 |
cellular detoxification of nitrogen compound |
GO:0071313 |
cellular response to caffeine |
GO:0098869 |
cellular oxidant detoxification |
|
|