Structure of PDB 1vam Chain B Binding Site BS01 |
|
|
Ligand ID | PNA |
InChI | InChI=1S/C12H15NO8/c14-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)13(18)19/h1-4,8-12,14-17H,5H2/t8-,9-,10+,11+,12+/m1/s1 |
InChIKey | IFBHRQDFSNCLOZ-GCHJQGSQSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 10.04 | [O-][N+](=O)c2ccc(OC1OC(C(O)C(O)C1O)CO)cc2 | OpenEye OEToolkits 1.5.0 | c1cc(ccc1[N+](=O)[O-])O[C@@H]2[C@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O | OpenEye OEToolkits 1.5.0 | c1cc(ccc1[N+](=O)[O-])OC2C(C(C(C(O2)CO)O)O)O | CACTVS 3.341 | OC[CH]1O[CH](Oc2ccc(cc2)[N+]([O-])=O)[CH](O)[CH](O)[CH]1O | CACTVS 3.341 | OC[C@H]1O[C@H](Oc2ccc(cc2)[N+]([O-])=O)[C@@H](O)[C@@H](O)[C@@H]1O |
|
Formula | C12 H15 N O8 |
Name | 4-nitrophenyl alpha-D-mannopyranoside; 4'-NITROPHENYL-ALPHA-D-MANNOPYRANOSIDE; 4-nitrophenyl alpha-D-mannoside; 4-nitrophenyl D-mannoside; 4-nitrophenyl mannoside |
ChEMBL | CHEMBL1173567 |
DrugBank | |
ZINC | ZINC000004282153
|
PDB chain | 1vam Chain B Residue 240
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
Enzyme Commision number |
? |
|
|
|