Structure of PDB 1ref Chain B Binding Site BS01 |
|
|
Ligand ID | C3X |
InChI | InChI=1S/C8H14O6/c9-5-3-14-8(7(11)6(5)10)13-2-4-1-12-4/h4-11H,1-3H2/t4-,5-,6+,7-,8-/m1/s1 |
InChIKey | JKWGJZWJCPSTJC-JAJWTYFOSA-N |
SMILES | Software | SMILES |
---|
OpenEye OEToolkits 1.5.0 | C1C(O1)COC2C(C(C(CO2)O)O)O | ACDLabs 10.04 | O(CC1OC1)C2OCC(O)C(O)C2O | OpenEye OEToolkits 1.5.0 | C1[C@@H](O1)CO[C@H]2[C@@H]([C@H]([C@@H](CO2)O)O)O | CACTVS 3.341 | O[CH]1CO[CH](OC[CH]2CO2)[CH](O)[CH]1O | CACTVS 3.341 | O[C@@H]1CO[C@@H](OC[C@H]2CO2)[C@H](O)[C@H]1O |
|
Formula | C8 H14 O6 |
Name | (2R)-oxiran-2-ylmethyl beta-D-xylopyranoside; 2,3-EPOXYPROPYL-BETA-D-XYLOSIDE; (2R)-oxiran-2-ylmethyl beta-D-xyloside; (2R)-oxiran-2-ylmethyl D-xyloside; (2R)-oxiran-2-ylmethyl xyloside |
ChEMBL | |
DrugBank | |
ZINC | ZINC000033821240
|
PDB chain | 1ref Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|