Structure of PDB 1ree Chain B Binding Site BS01 |
|
|
Ligand ID | 07E |
InChI | InChI=1S/C9H18O6/c1-5(10)2-3-14-9-8(13)7(12)6(11)4-15-9/h5-13H,2-4H2,1H3/t5-,6+,7-,8+,9+/m0/s1 |
InChIKey | KAKVKOIRYXYSBS-KVEIKIFDSA-N |
SMILES | Software | SMILES |
---|
ACDLabs 12.01 | O(CCC(O)C)C1OCC(O)C(O)C1O | CACTVS 3.370 | C[CH](O)CCO[CH]1OC[CH](O)[CH](O)[CH]1O | OpenEye OEToolkits 1.7.2 | C[C@@H](CCO[C@H]1[C@@H]([C@H]([C@@H](CO1)O)O)O)O | CACTVS 3.370 | C[C@H](O)CCO[C@@H]1OC[C@@H](O)[C@H](O)[C@H]1O | OpenEye OEToolkits 1.7.2 | CC(CCOC1C(C(C(CO1)O)O)O)O |
|
Formula | C9 H18 O6 |
Name | (3S)-3-hydroxybutyl beta-D-xylopyranoside; (3S)-3-hydroxybutyl beta-D-xyloside; (3S)-3-hydroxybutyl D-xyloside; (3S)-3-hydroxybutyl xyloside |
ChEMBL | |
DrugBank | |
ZINC |
|
PDB chain | 1ree Chain B Residue 401
[Download ligand structure]
[Download structure with residue number starting from 1]
[View ligand structure]
|
|
|
|
|
|
|